C18H29NO2 — CID 58223662
(Z)-4-methyl-N-[(2R,3R,6R)-2-methyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]pent-2-enamide (PubChem CID 58223662) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is (Z)-4-methyl-N-[(2R,3R,6R)-2-methyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]pent-2-enamide.
| Compound Name | (Z)-4-methyl-N-[(2R,3R,6R)-2-methyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]pent-2-enamide |
|---|---|
| PubChem CID | 58223662 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (Z)-4-methyl-N-[(2R,3R,6R)-2-methyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]pent-2-enamide |
| SMILES | C=C/C(C)=C/C[C@H]1CC[C@@H](NC(=O)/C=C\C(C)C)[C@@H](C)O1 |
| InChI | InChI=1S/C18H29NO2/c1-6-14(4)8-9-16-10-11-17(15(5)21-16)19-18(20)12-7-13(2)3/h6-8,12-13,15-17H,1,9-11H2,2-5H3,(H,19,20)/b12-7-,14-8+/t15-,16+,17-/m1/s1 |
| InChIKey | NVRMYAQAUPHDGQ-KETXCYDFSA-N |
| XLogP | 3.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|