C25H39NO5 — CID 58223669
(Z)-N-[(2R,3R,6R)-6-[(2E,4E)-5-[(3R,4R,5R,7S)-4-hydroxy-7-methyl-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2-methyloxan-3-yl]-4-methylpent-2-enamide (PubChem CID 58223669) has the molecular formula C25H39NO5 and a molecular weight of 433.59 g/mol. Its IUPAC name is (Z)-N-[(2R,3R,6R)-6-[(2E,4E)-5-[(3R,4R,5R,7S)-4-hydroxy-7-methyl-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2-methyloxan-3-yl]-4-methylpent-2-enamide.
| Compound Name | (Z)-N-[(2R,3R,6R)-6-[(2E,4E)-5-[(3R,4R,5R,7S)-4-hydroxy-7-methyl-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2-methyloxan-3-yl]-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 58223669 |
| Molecular Formula | C25H39NO5 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | (Z)-N-[(2R,3R,6R)-6-[(2E,4E)-5-[(3R,4R,5R,7S)-4-hydroxy-7-methyl-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2-methyloxan-3-yl]-4-methylpent-2-enamide |
| SMILES | CC(/C=C/[C@H]1O[C@@H](C)C[C@@]2(CO2)[C@@H]1O)=C\C[C@H]1CC[C@@H](NC(=O)/C=C\C(C)C)[C@@H](C)O1 |
| InChI | InChI=1S/C25H39NO5/c1-16(2)6-13-23(27)26-21-11-10-20(31-19(21)5)9-7-17(3)8-12-22-24(28)25(15-29-25)14-18(4)30-22/h6-8,12-13,16,18-22,24,28H,9-11,14-15H2,1-5H3,(H,26,27)/b12-8+,13-6-,17-7+/t18-,19+,20-,21+,22+,24+,25+/m0/s1 |
| InChIKey | ANSMJPVWTDSTJQ-UGWGCQECSA-N |
| XLogP | 3.45 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|