C17H27NO3 — CID 58223670
(Z)-4-methyl-N-[(2R,3R,6R)-2-methyl-6-[(E)-3-methyl-4-oxobut-2-enyl]oxan-3-yl]pent-2-enamide (PubChem CID 58223670) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is (Z)-4-methyl-N-[(2R,3R,6R)-2-methyl-6-[(E)-3-methyl-4-oxobut-2-enyl]oxan-3-yl]pent-2-enamide.
| Compound Name | (Z)-4-methyl-N-[(2R,3R,6R)-2-methyl-6-[(E)-3-methyl-4-oxobut-2-enyl]oxan-3-yl]pent-2-enamide |
|---|---|
| PubChem CID | 58223670 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | (Z)-4-methyl-N-[(2R,3R,6R)-2-methyl-6-[(E)-3-methyl-4-oxobut-2-enyl]oxan-3-yl]pent-2-enamide |
| SMILES | C/C(C=O)=C\C[C@H]1CC[C@@H](NC(=O)/C=C\C(C)C)[C@@H](C)O1 |
| InChI | InChI=1S/C17H27NO3/c1-12(2)5-10-17(20)18-16-9-8-15(21-14(16)4)7-6-13(3)11-19/h5-6,10-12,14-16H,7-9H2,1-4H3,(H,18,20)/b10-5-,13-6+/t14-,15+,16-/m1/s1 |
| InChIKey | GHHPFTRAUFPOQX-QILLCJQESA-N |
| XLogP | 2.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|