C15H28N2+2 — CID 58223811
(3aS,7aS)-2,2-dimethyl-1,3-di(propan-2-ylidene)-3a,4,5,6,7,7a-hexahydrobenzimidazole-1,3-diium (PubChem CID 58223811) has the molecular formula C15H28N2+2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (3aS,7aS)-2,2-dimethyl-1,3-di(propan-2-ylidene)-3a,4,5,6,7,7a-hexahydrobenzimidazole-1,3-diium.
| Compound Name | (3aS,7aS)-2,2-dimethyl-1,3-di(propan-2-ylidene)-3a,4,5,6,7,7a-hexahydrobenzimidazole-1,3-diium |
|---|---|
| PubChem CID | 58223811 |
| Molecular Formula | C15H28N2+2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.22 |
| IUPAC Name | (3aS,7aS)-2,2-dimethyl-1,3-di(propan-2-ylidene)-3a,4,5,6,7,7a-hexahydrobenzimidazole-1,3-diium |
| SMILES | CC(C)=[N+]1[C@H]2CCCC[C@@H]2[N+](=C(C)C)C1(C)C |
| InChI | InChI=1S/C15H28N2/c1-11(2)16-13-9-7-8-10-14(13)17(12(3)4)15(16,5)6/h13-14H,7-10H2,1-6H3/q+2/t13-,14-/m0/s1 |
| InChIKey | XJFRHEIXJTXHHE-KBPBESRZSA-N |
| XLogP | 3.03 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|