C20H20 — CID 58224098
18,18-dimethylpentacyclo[13.2.1.04,17.05,10.011,16]octadeca-5,7,9,11(16),12,14-hexaene (PubChem CID 58224098) has the molecular formula C20H20 and a molecular weight of 260.38 g/mol. Its IUPAC name is 18,18-dimethylpentacyclo[13.2.1.04,17.05,10.011,16]octadeca-5,7,9,11(16),12,14-hexaene.
| Compound Name | 18,18-dimethylpentacyclo[13.2.1.04,17.05,10.011,16]octadeca-5,7,9,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 58224098 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 18,18-dimethylpentacyclo[13.2.1.04,17.05,10.011,16]octadeca-5,7,9,11(16),12,14-hexaene |
| SMILES | CC1(C)c2cccc3c2C2C(CCC21)c1ccccc1-3 |
| InChI | InChI=1S/C20H20/c1-20(2)16-9-5-8-14-12-6-3-4-7-13(12)15-10-11-17(20)19(15)18(14)16/h3-9,15,17,19H,10-11H2,1-2H3 |
| InChIKey | HCWRELLPJQAJHA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |