About 2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane
2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane (PubChem CID 58224184) has the molecular formula C15H18F2O3
and a molecular weight of 284.30 g/mol. Its IUPAC name is 2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane.
Molecular Properties
| Compound Name | 2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane |
| PubChem CID | 58224184 |
| Molecular Formula | C15H18F2O3 |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane |
| SMILES | C[C@@H](OC1CCCCO1)[C@@]1(c2cc(F)ccc2F)CO1 |
| InChI | InChI=1S/C15H18F2O3/c1-10(20-14-4-2-3-7-18-14)15(9-19-15)12-8-11(16)5-6-13(12)17/h5-6,8,10,14H,2-4,7,9H2,1H3/t10-,14?,15-/m1/s1 |
| InChIKey | HEVFNDSPMJBYLT-GIFVDNBISA-N |
| XLogP | 3.12 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane?
The IUPAC name of 2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane (CID 58224184) is 2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane.
What is the SMILES notation for 2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane?
The canonical SMILES for 2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane is C[C@@H](OC1CCCCO1)[C@@]1(c2cc(F)ccc2F)CO1.
What is the InChIKey of 2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane?
The InChIKey is HEVFNDSPMJBYLT-GIFVDNBISA-N. The full InChI is InChI=1S/C15H18F2O3/c1-10(20-14-4-2-3-7-18-14)15(9-19-15)12-8-11(16)5-6-13(12)17/h5-6,8,10,14H,2-4,7,9H2,1H3/t10-,14?,15-/m1/s1.
What are the key properties of 2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane?
2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane has a molecular weight of 284.30 g/mol, XLogP of 3.12, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-1-[(2R)-2-(2,5-difluorophenyl)oxiran-2-yl]ethoxy]oxane is sourced from PubChem (CID 58224184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).