About N,2-bis(2,4,6-trimethylphenyl)ethanimine
N,2-bis(2,4,6-trimethylphenyl)ethanimine (PubChem CID 58224188) has the molecular formula C20H25N
and a molecular weight of 279.43 g/mol. Its IUPAC name is N,2-bis(2,4,6-trimethylphenyl)ethanimine.
Molecular Properties
| Compound Name | N,2-bis(2,4,6-trimethylphenyl)ethanimine |
| PubChem CID | 58224188 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | N,2-bis(2,4,6-trimethylphenyl)ethanimine |
| SMILES | Cc1cc(C)c(C/C=N/c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C20H25N/c1-13-9-15(3)19(16(4)10-13)7-8-21-20-17(5)11-14(2)12-18(20)6/h8-12H,7H2,1-6H3/b21-8+ |
| InChIKey | KTKYQHGNPZVQQW-ODCIPOBUSA-N |
| XLogP | 5.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,2-bis(2,4,6-trimethylphenyl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-bis(2,4,6-trimethylphenyl)ethanimine?
The IUPAC name of N,2-bis(2,4,6-trimethylphenyl)ethanimine (CID 58224188) is N,2-bis(2,4,6-trimethylphenyl)ethanimine.
What is the SMILES notation for N,2-bis(2,4,6-trimethylphenyl)ethanimine?
The canonical SMILES for N,2-bis(2,4,6-trimethylphenyl)ethanimine is Cc1cc(C)c(C/C=N/c2c(C)cc(C)cc2C)c(C)c1.
What is the InChIKey of N,2-bis(2,4,6-trimethylphenyl)ethanimine?
The InChIKey is KTKYQHGNPZVQQW-ODCIPOBUSA-N. The full InChI is InChI=1S/C20H25N/c1-13-9-15(3)19(16(4)10-13)7-8-21-20-17(5)11-14(2)12-18(20)6/h8-12H,7H2,1-6H3/b21-8+.
What are the key properties of N,2-bis(2,4,6-trimethylphenyl)ethanimine?
N,2-bis(2,4,6-trimethylphenyl)ethanimine has a molecular weight of 279.43 g/mol, XLogP of 5.48, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-bis(2,4,6-trimethylphenyl)ethanimine is sourced from PubChem (CID 58224188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).