C32H26N4S2 — CID 58224190
N-[(Z)-[(18Z)-2,6,11,15-tetramethyl-18-(phenylhydrazinylidene)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene]amino]aniline (PubChem CID 58224190) has the molecular formula C32H26N4S2 and a molecular weight of 530.72 g/mol. Its IUPAC name is N-[(Z)-[(18Z)-2,6,11,15-tetramethyl-18-(phenylhydrazinylidene)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene]amino]aniline.
| Compound Name | N-[(Z)-[(18Z)-2,6,11,15-tetramethyl-18-(phenylhydrazinylidene)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene]amino]aniline |
|---|---|
| PubChem CID | 58224190 |
| Molecular Formula | C32H26N4S2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | N-[(Z)-[(18Z)-2,6,11,15-tetramethyl-18-(phenylhydrazinylidene)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-9-ylidene]amino]aniline |
| SMILES | Cc1cc2/c(=N\Nc3ccccc3)c3c(C)c4c(c(C)c3c2s1)/c(=N/Nc1ccccc1)c1cc(C)sc14 |
| InChI | InChI=1S/C32H26N4S2/c1-17-15-23-29(35-33-21-11-7-5-8-12-21)25-20(4)28-26(19(3)27(25)31(23)37-17)30(24-16-18(2)38-32(24)28)36-34-22-13-9-6-10-14-22/h5-16,33-34H,1-4H3/b35-29+,36-30+ |
| InChIKey | XYJJMXBZGFZKAC-ZRBLUKEISA-N |
| XLogP | 8.39 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|