C36H26S4 — CID 58224194
2,11-dimethyl-6,15-bis(5-methyl-1-benzothiophen-2-yl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene (PubChem CID 58224194) has the molecular formula C36H26S4 and a molecular weight of 586.87 g/mol. Its IUPAC name is 2,11-dimethyl-6,15-bis(5-methyl-1-benzothiophen-2-yl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene.
| Compound Name | 2,11-dimethyl-6,15-bis(5-methyl-1-benzothiophen-2-yl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene |
|---|---|
| PubChem CID | 58224194 |
| Molecular Formula | C36H26S4 |
| Molecular Weight | 586.87 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | 2,11-dimethyl-6,15-bis(5-methyl-1-benzothiophen-2-yl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene |
| SMILES | Cc1ccc2sc(-c3cc4c(s3)-c3c(C)c5c(c(C)c3C4)-c3sc(-c4cc6cc(C)ccc6s4)cc3C5)cc2c1 |
| InChI | InChI=1S/C36H26S4/c1-17-5-7-27-21(9-17)13-29(37-27)31-15-23-11-25-20(4)34-26(19(3)33(25)35(23)39-31)12-24-16-32(40-36(24)34)30-14-22-10-18(2)6-8-28(22)38-30/h5-10,13-16H,11-12H2,1-4H3 |
| InChIKey | ATYUCWARSGKFKH-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.87 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |