C32H26S2 — CID 58224210
9,18-dimethyl-6,15-bis(4-methylphenyl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene (PubChem CID 58224210) has the molecular formula C32H26S2 and a molecular weight of 474.69 g/mol. Its IUPAC name is 9,18-dimethyl-6,15-bis(4-methylphenyl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene.
| Compound Name | 9,18-dimethyl-6,15-bis(4-methylphenyl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene |
|---|---|
| PubChem CID | 58224210 |
| Molecular Formula | C32H26S2 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 9,18-dimethyl-6,15-bis(4-methylphenyl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene |
| SMILES | Cc1ccc(-c2cc3c(s2)-c2cc4c(cc2C3C)-c2sc(-c3ccc(C)cc3)cc2C4C)cc1 |
| InChI | InChI=1S/C32H26S2/c1-17-5-9-21(10-6-17)29-15-25-19(3)23-14-28-24(13-27(23)31(25)33-29)20(4)26-16-30(34-32(26)28)22-11-7-18(2)8-12-22/h5-16,19-20H,1-4H3 |
| InChIKey | KLRIRIQLZBCPLX-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |