C34H22S6 — CID 58224324
6,15-bis[5-(5-methylthiophen-2-yl)thiophen-2-yl]-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene (PubChem CID 58224324) has the molecular formula C34H22S6 and a molecular weight of 622.95 g/mol. Its IUPAC name is 6,15-bis[5-(5-methylthiophen-2-yl)thiophen-2-yl]-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene.
| Compound Name | 6,15-bis[5-(5-methylthiophen-2-yl)thiophen-2-yl]-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene |
|---|---|
| PubChem CID | 58224324 |
| Molecular Formula | C34H22S6 |
| Molecular Weight | 622.95 g/mol |
| Exact Mass | 622.00 |
| IUPAC Name | 6,15-bis[5-(5-methylthiophen-2-yl)thiophen-2-yl]-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene |
| SMILES | Cc1ccc(-c2ccc(-c3cc4c(s3)-c3cc5c(cc3C4)-c3sc(-c4ccc(-c6ccc(C)s6)s4)cc3C5)s2)s1 |
| InChI | InChI=1S/C34H22S6/c1-17-3-5-25(35-17)27-7-9-29(37-27)31-15-21-11-19-14-24-20(13-23(19)33(21)39-31)12-22-16-32(40-34(22)24)30-10-8-28(38-30)26-6-4-18(2)36-26/h3-10,13-16H,11-12H2,1-2H3 |
| InChIKey | IODCDMNKRUGAFW-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.95 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |