C30H22O4S2 — CID 58224385
2,5-bis[5-(4-methylphenyl)thiophen-2-yl]terephthalic acid (PubChem CID 58224385) has the molecular formula C30H22O4S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 2,5-bis[5-(4-methylphenyl)thiophen-2-yl]terephthalic acid.
| Compound Name | 2,5-bis[5-(4-methylphenyl)thiophen-2-yl]terephthalic acid |
|---|---|
| PubChem CID | 58224385 |
| Molecular Formula | C30H22O4S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 2,5-bis[5-(4-methylphenyl)thiophen-2-yl]terephthalic acid |
| SMILES | Cc1ccc(-c2ccc(-c3cc(C(=O)O)c(-c4ccc(-c5ccc(C)cc5)s4)cc3C(=O)O)s2)cc1 |
| InChI | InChI=1S/C30H22O4S2/c1-17-3-7-19(8-4-17)25-11-13-27(35-25)21-15-24(30(33)34)22(16-23(21)29(31)32)28-14-12-26(36-28)20-9-5-18(2)6-10-20/h3-16H,1-2H3,(H,31,32)(H,33,34) |
| InChIKey | UMYAEUASDLZHCP-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |