C18H12Br2S2 — CID 58224390
6,15-dibromo-9,18-dimethyl-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene (PubChem CID 58224390) has the molecular formula C18H12Br2S2 and a molecular weight of 452.24 g/mol. Its IUPAC name is 6,15-dibromo-9,18-dimethyl-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene.
| Compound Name | 6,15-dibromo-9,18-dimethyl-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene |
|---|---|
| PubChem CID | 58224390 |
| Molecular Formula | C18H12Br2S2 |
| Molecular Weight | 452.24 g/mol |
| Exact Mass | 449.87 |
| IUPAC Name | 6,15-dibromo-9,18-dimethyl-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene |
| SMILES | CC1c2cc3c(cc2-c2sc(Br)cc21)C(C)c1cc(Br)sc1-3 |
| InChI | InChI=1S/C18H12Br2S2/c1-7-9-3-14-10(8(2)12-6-16(20)22-18(12)14)4-13(9)17-11(7)5-15(19)21-17/h3-8H,1-2H3 |
| InChIKey | AJPPQPIEAVECDZ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.24 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |