About 1,1,2-tripropylhydrazine
1,1,2-tripropylhydrazine (PubChem CID 582244) has the molecular formula C9H22N2
and a molecular weight of 158.29 g/mol. Its IUPAC name is 1,1,2-tripropylhydrazine.
Molecular Properties
| Compound Name | 1,1,2-tripropylhydrazine |
| PubChem CID | 582244 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | 1,1,2-tripropylhydrazine |
| SMILES | CCCNN(CCC)CCC |
| InChI | InChI=1S/C9H22N2/c1-4-7-10-11(8-5-2)9-6-3/h10H,4-9H2,1-3H3 |
| InChIKey | JOGSSTIPCUFRHC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2-tripropylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-tripropylhydrazine?
The IUPAC name of 1,1,2-tripropylhydrazine (CID 582244) is 1,1,2-tripropylhydrazine.
What is the SMILES notation for 1,1,2-tripropylhydrazine?
The canonical SMILES for 1,1,2-tripropylhydrazine is CCCNN(CCC)CCC.
What is the InChIKey of 1,1,2-tripropylhydrazine?
The InChIKey is JOGSSTIPCUFRHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2/c1-4-7-10-11(8-5-2)9-6-3/h10H,4-9H2,1-3H3.
What are the key properties of 1,1,2-tripropylhydrazine?
1,1,2-tripropylhydrazine has a molecular weight of 158.29 g/mol, XLogP of 2.02, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-tripropylhydrazine is sourced from PubChem (CID 582244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).