C12H9F9OS — CID 58224428
2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyethylsulfanylbenzene (PubChem CID 58224428) has the molecular formula C12H9F9OS and a molecular weight of 372.25 g/mol. Its IUPAC name is 2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyethylsulfanylbenzene.
| Compound Name | 2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyethylsulfanylbenzene |
|---|---|
| PubChem CID | 58224428 |
| Molecular Formula | C12H9F9OS |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyethylsulfanylbenzene |
| SMILES | FC(F)(F)C(OCCSc1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H9F9OS/c13-10(14,15)9(11(16,17)18,12(19,20)21)22-6-7-23-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | ZPPOEMNFVDZBCN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|