C24H48N2+2 — CID 58224449
2,7,8-triethyl-3-[2-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)ethyl]-5-azoniaspiro[4.4]nonane (PubChem CID 58224449) has the molecular formula C24H48N2+2 and a molecular weight of 364.66 g/mol. Its IUPAC name is 2,7,8-triethyl-3-[2-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)ethyl]-5-azoniaspiro[4.4]nonane.
| Compound Name | 2,7,8-triethyl-3-[2-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)ethyl]-5-azoniaspiro[4.4]nonane |
|---|---|
| PubChem CID | 58224449 |
| Molecular Formula | C24H48N2+2 |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 364.38 |
| IUPAC Name | 2,7,8-triethyl-3-[2-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)ethyl]-5-azoniaspiro[4.4]nonane |
| SMILES | CCC1C[N+](C)(C)CC1CCC1C[N+]2(CC(CC)C(CC)C2)CC1CC |
| InChI | InChI=1S/C24H48N2/c1-7-19-13-25(5,6)14-23(19)11-12-24-18-26(17-22(24)10-4)15-20(8-2)21(9-3)16-26/h19-24H,7-18H2,1-6H3/q+2 |
| InChIKey | XUYVOSIGYXMPNJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|