C25H17FN4 — CID 58224972
2-(4-fluoro-3-isocyanophenyl)-19,20,21-triazatetracyclo[13.3.1.13,7.19,13]henicosa-1(18),3,5,7(21),9(20),10,12,15(19),16-nonaene (PubChem CID 58224972) has the molecular formula C25H17FN4 and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-(4-fluoro-3-isocyanophenyl)-19,20,21-triazatetracyclo[13.3.1.13,7.19,13]henicosa-1(18),3,5,7(21),9(20),10,12,15(19),16-nonaene.
| Compound Name | 2-(4-fluoro-3-isocyanophenyl)-19,20,21-triazatetracyclo[13.3.1.13,7.19,13]henicosa-1(18),3,5,7(21),9(20),10,12,15(19),16-nonaene |
|---|---|
| PubChem CID | 58224972 |
| Molecular Formula | C25H17FN4 |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-(4-fluoro-3-isocyanophenyl)-19,20,21-triazatetracyclo[13.3.1.13,7.19,13]henicosa-1(18),3,5,7(21),9(20),10,12,15(19),16-nonaene |
| SMILES | [C-]#[N+]c1cc(C2c3cccc(n3)Cc3cccc(n3)Cc3cccc2n3)ccc1F |
| InChI | InChI=1S/C25H17FN4/c1-27-24-13-16(11-12-21(24)26)25-22-9-3-7-19(29-22)14-17-5-2-6-18(28-17)15-20-8-4-10-23(25)30-20/h2-13,25H,14-15H2 |
| InChIKey | IXBVCOAOXNUVJN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|