C18H9F6N3 — CID 58225109
2,2,8,8,14,14-hexafluoro-19,20,21-triazatetracyclo[13.3.1.13,7.19,13]henicosa-1(19),3(21),4,6,9(20),10,12,15,17-nonaene (PubChem CID 58225109) has the molecular formula C18H9F6N3 and a molecular weight of 381.28 g/mol. Its IUPAC name is 2,2,8,8,14,14-hexafluoro-19,20,21-triazatetracyclo[13.3.1.13,7.19,13]henicosa-1(19),3(21),4,6,9(20),10,12,15,17-nonaene.
| Compound Name | 2,2,8,8,14,14-hexafluoro-19,20,21-triazatetracyclo[13.3.1.13,7.19,13]henicosa-1(19),3(21),4,6,9(20),10,12,15,17-nonaene |
|---|---|
| PubChem CID | 58225109 |
| Molecular Formula | C18H9F6N3 |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 2,2,8,8,14,14-hexafluoro-19,20,21-triazatetracyclo[13.3.1.13,7.19,13]henicosa-1(19),3(21),4,6,9(20),10,12,15,17-nonaene |
| SMILES | FC1(F)c2cccc(n2)C(F)(F)c2cccc(n2)C(F)(F)c2cccc1n2 |
| InChI | InChI=1S/C18H9F6N3/c19-16(20)10-4-1-5-11(25-10)17(21,22)13-7-3-9-15(27-13)18(23,24)14-8-2-6-12(16)26-14/h1-9H |
| InChIKey | WMNKXASNRADXNY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |