C12H18N2O2 — CID 58225399
(3S,4R)-3,4,5,5-tetradeuterio-4-[dideuterio-[5-deuterio-2-methyl-3-(trideuteriomethyl)imidazol-4-yl]methyl]-3-(2,2,2-trideuterioethyl)oxolan-2-one (PubChem CID 58225399) has the molecular formula C12H18N2O2 and a molecular weight of 235.37 g/mol. Its IUPAC name is (3S,4R)-3,4,5,5-tetradeuterio-4-[dideuterio-[5-deuterio-2-methyl-3-(trideuteriomethyl)imidazol-4-yl]methyl]-3-(2,2,2-trideuterioethyl)oxolan-2-one.
| Compound Name | (3S,4R)-3,4,5,5-tetradeuterio-4-[dideuterio-[5-deuterio-2-methyl-3-(trideuteriomethyl)imidazol-4-yl]methyl]-3-(2,2,2-trideuterioethyl)oxolan-2-one |
|---|---|
| PubChem CID | 58225399 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.22 |
| IUPAC Name | (3S,4R)-3,4,5,5-tetradeuterio-4-[dideuterio-[5-deuterio-2-methyl-3-(trideuteriomethyl)imidazol-4-yl]methyl]-3-(2,2,2-trideuterioethyl)oxolan-2-one |
| SMILES | [2H]c1nc(C)n(C([2H])([2H])[2H])c1C([2H])([2H])[C@@]1([2H])C([2H])([2H])OC(=O)[C@@]1([2H])CC([2H])([2H])[2H] |
| InChI | InChI=1S/C12H18N2O2/c1-4-11-9(7-16-12(11)15)5-10-6-13-8(2)14(10)3/h6,9,11H,4-5,7H2,1-3H3/t9-,11-/m0/s1/i1D3,3D3,5D2,6D,7D2,9D,11D |
| InChIKey | GEQJWOJTKFWRQO-WNYIKMDKSA-N |
| XLogP | 1.47 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |