C8H9F15O4Si4 — CID 58225542
2,2,4-trimethyl-4,6,6,8,8-pentakis(trifluoromethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 58225542) has the molecular formula C8H9F15O4Si4 and a molecular weight of 566.47 g/mol. Its IUPAC name is 2,2,4-trimethyl-4,6,6,8,8-pentakis(trifluoromethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,2,4-trimethyl-4,6,6,8,8-pentakis(trifluoromethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 58225542 |
| Molecular Formula | C8H9F15O4Si4 |
| Molecular Weight | 566.47 g/mol |
| Exact Mass | 565.93 |
| IUPAC Name | 2,2,4-trimethyl-4,6,6,8,8-pentakis(trifluoromethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[Si]1(C)O[Si](C)(C(F)(F)F)O[Si](C(F)(F)F)(C(F)(F)F)O[Si](C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C8H9F15O4Si4/c1-28(2)24-29(3,4(9,10)11)26-31(7(18,19)20,8(21,22)23)27-30(25-28,5(12,13)14)6(15,16)17/h1-3H3 |
| InChIKey | AAHOJGVMTGGDEQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|