About [3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate
[3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate (PubChem CID 58225884) has the molecular formula C23H28F2O4
and a molecular weight of 406.47 g/mol. Its IUPAC name is [3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate.
Molecular Properties
| Compound Name | [3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate |
| PubChem CID | 58225884 |
| Molecular Formula | C23H28F2O4 |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate |
| SMILES | Cc1ccc(C23CC4CC(CC(COC(=O)CCOC(=O)C(F)F)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H28F2O4/c1-15-2-4-18(5-3-15)23-11-16-8-17(12-23)10-22(9-16,13-23)14-29-19(26)6-7-28-21(27)20(24)25/h2-5,16-17,20H,6-14H2,1H3 |
| InChIKey | WNEHNKYDJBMDGB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate?
The IUPAC name of [3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate (CID 58225884) is [3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate.
What is the SMILES notation for [3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate?
The canonical SMILES for [3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate is Cc1ccc(C23CC4CC(CC(COC(=O)CCOC(=O)C(F)F)(C4)C2)C3)cc1.
What is the InChIKey of [3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate?
The InChIKey is WNEHNKYDJBMDGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28F2O4/c1-15-2-4-18(5-3-15)23-11-16-8-17(12-23)10-22(9-16,13-23)14-29-19(26)6-7-28-21(27)20(24)25/h2-5,16-17,20H,6-14H2,1H3.
What are the key properties of [3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate?
[3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate has a molecular weight of 406.47 g/mol, XLogP of 4.57, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-methylphenyl)-1-adamantyl]methyl 3-(2,2-difluoroacetyl)oxypropanoate is sourced from PubChem (CID 58225884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).