About 2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate
2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate (PubChem CID 58225890) has the molecular formula C14H20F2O3
and a molecular weight of 274.31 g/mol. Its IUPAC name is 2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate.
Molecular Properties
| Compound Name | 2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate |
| PubChem CID | 58225890 |
| Molecular Formula | C14H20F2O3 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate |
| SMILES | O=C(OCC(F)F)C12CC3CC(CC(CO)(C3)C1)C2 |
| InChI | InChI=1S/C14H20F2O3/c15-11(16)6-19-12(18)14-4-9-1-10(5-14)3-13(2-9,7-14)8-17/h9-11,17H,1-8H2 |
| InChIKey | FLKGXPPBLBNWMX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate?
The IUPAC name of 2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate (CID 58225890) is 2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate.
What is the SMILES notation for 2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate?
The canonical SMILES for 2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate is O=C(OCC(F)F)C12CC3CC(CC(CO)(C3)C1)C2.
What is the InChIKey of 2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate?
The InChIKey is FLKGXPPBLBNWMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2O3/c15-11(16)6-19-12(18)14-4-9-1-10(5-14)3-13(2-9,7-14)8-17/h9-11,17H,1-8H2.
What are the key properties of 2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate?
2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate has a molecular weight of 274.31 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroethyl 3-(hydroxymethyl)adamantane-1-carboxylate is sourced from PubChem (CID 58225890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).