C10H13FO4 — CID 58225894
(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-fluoropropanoate (PubChem CID 58225894) has the molecular formula C10H13FO4 and a molecular weight of 216.21 g/mol. Its IUPAC name is (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-fluoropropanoate.
| Compound Name | (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-fluoropropanoate |
|---|---|
| PubChem CID | 58225894 |
| Molecular Formula | C10H13FO4 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 2-fluoropropanoate |
| SMILES | CC(F)C(=O)OC1CCC2CC1OC2=O |
| InChI | InChI=1S/C10H13FO4/c1-5(11)9(12)14-7-3-2-6-4-8(7)15-10(6)13/h5-8H,2-4H2,1H3 |
| InChIKey | GJPXBLCBXLKJSQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |