About 4-methyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one
4-methyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one (PubChem CID 58226012) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is 4-methyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one.
Analyze 4-methyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one?
The IUPAC name of 4-methyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one (CID 58226012) is 4-methyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one.
What is the SMILES notation for 4-methyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one?
The canonical SMILES for 4-methyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one is CC1OC2OC3CC(=O)OC3C2O1.
What is the InChIKey of 4-methyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one?
The InChIKey is BZJQWSXPBMEXEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5/c1-3-10-7-6-4(2-5(9)13-6)12-8(7)11-3/h3-4,6-8H,2H2,1H3.
What are the key properties of 4-methyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one?
4-methyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one has a molecular weight of 186.16 g/mol, XLogP of -0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one is sourced from PubChem (CID 58226012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).