C11H17F3O3 — CID 58226061
(1,1,1-trifluoro-2-hydroxy-2,4-dimethylpentan-3-yl) 2-methylprop-2-enoate (PubChem CID 58226061) has the molecular formula C11H17F3O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-hydroxy-2,4-dimethylpentan-3-yl) 2-methylprop-2-enoate.
| Compound Name | (1,1,1-trifluoro-2-hydroxy-2,4-dimethylpentan-3-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58226061 |
| Molecular Formula | C11H17F3O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (1,1,1-trifluoro-2-hydroxy-2,4-dimethylpentan-3-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C(C)C)C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C11H17F3O3/c1-6(2)8(17-9(15)7(3)4)10(5,16)11(12,13)14/h6,8,16H,3H2,1-2,4-5H3 |
| InChIKey | DREMJZZYCFAENE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|