C12H19F3O3 — CID 58226065
(1,1,1-trifluoro-2-hydroxy-2,5-dimethylhexan-3-yl) 2-methylprop-2-enoate (PubChem CID 58226065) has the molecular formula C12H19F3O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-hydroxy-2,5-dimethylhexan-3-yl) 2-methylprop-2-enoate.
| Compound Name | (1,1,1-trifluoro-2-hydroxy-2,5-dimethylhexan-3-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58226065 |
| Molecular Formula | C12H19F3O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (1,1,1-trifluoro-2-hydroxy-2,5-dimethylhexan-3-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC(C)C)C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C12H19F3O3/c1-7(2)6-9(18-10(16)8(3)4)11(5,17)12(13,14)15/h7,9,17H,3,6H2,1-2,4-5H3 |
| InChIKey | FGDKTNCATRDWQG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|