About [3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate
[3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate (PubChem CID 58226325) has the molecular formula C22H26F2O4
and a molecular weight of 392.44 g/mol. Its IUPAC name is [3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate.
Molecular Properties
| Compound Name | [3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate |
| PubChem CID | 58226325 |
| Molecular Formula | C22H26F2O4 |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC23CC4CC(CC(COC(=O)C(C)(F)F)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H26F2O4/c1-14-3-5-17(6-4-14)18(25)28-22-10-15-7-16(11-22)9-21(8-15,12-22)13-27-19(26)20(2,23)24/h3-6,15-16H,7-13H2,1-2H3 |
| InChIKey | NTCHQKZCRAZMNY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate?
The IUPAC name of [3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate (CID 58226325) is [3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate.
What is the SMILES notation for [3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate?
The canonical SMILES for [3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate is Cc1ccc(C(=O)OC23CC4CC(CC(COC(=O)C(C)(F)F)(C4)C2)C3)cc1.
What is the InChIKey of [3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate?
The InChIKey is NTCHQKZCRAZMNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26F2O4/c1-14-3-5-17(6-4-14)18(25)28-22-10-15-7-16(11-22)9-21(8-15,12-22)13-27-19(26)20(2,23)24/h3-6,15-16H,7-13H2,1-2H3.
What are the key properties of [3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate?
[3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate has a molecular weight of 392.44 g/mol, XLogP of 4.69, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,2-difluoropropanoyloxymethyl)-1-adamantyl] 4-methylbenzoate is sourced from PubChem (CID 58226325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).