C21H25ClO6 — CID 58226431
[3-(4-chloro-2-ethyl-6-methoxyphenyl)-2-oxo-1-oxaspiro[4.5]dec-3-en-4-yl] ethyl carbonate (PubChem CID 58226431) has the molecular formula C21H25ClO6 and a molecular weight of 408.88 g/mol. Its IUPAC name is [3-(4-chloro-2-ethyl-6-methoxyphenyl)-2-oxo-1-oxaspiro[4.5]dec-3-en-4-yl] ethyl carbonate.
| Compound Name | [3-(4-chloro-2-ethyl-6-methoxyphenyl)-2-oxo-1-oxaspiro[4.5]dec-3-en-4-yl] ethyl carbonate |
|---|---|
| PubChem CID | 58226431 |
| Molecular Formula | C21H25ClO6 |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [3-(4-chloro-2-ethyl-6-methoxyphenyl)-2-oxo-1-oxaspiro[4.5]dec-3-en-4-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1=C(c2c(CC)cc(Cl)cc2OC)C(=O)OC12CCCCC2 |
| InChI | InChI=1S/C21H25ClO6/c1-4-13-11-14(22)12-15(25-3)16(13)17-18(27-20(24)26-5-2)21(28-19(17)23)9-7-6-8-10-21/h11-12H,4-10H2,1-3H3 |
| InChIKey | JVWJAQVEGUPIMF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |