About 2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium
2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium (PubChem CID 58226479) has the molecular formula C10H11OY-
and a molecular weight of 236.10 g/mol. Its IUPAC name is 2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium.
Molecular Properties
| Compound Name | 2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium |
| PubChem CID | 58226479 |
| Molecular Formula | C10H11OY- |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium |
| SMILES | Cc1c[c-]cc(C)c1CC=O.[Y] |
| InChI | InChI=1S/C10H11O.Y/c1-8-4-3-5-9(2)10(8)6-7-11;/h4-5,7H,6H2,1-2H3;/q-1; |
| InChIKey | WTUKPGDQTIWDDG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium?
The IUPAC name of 2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium (CID 58226479) is 2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium.
What is the SMILES notation for 2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium?
The canonical SMILES for 2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium is Cc1c[c-]cc(C)c1CC=O.[Y].
What is the InChIKey of 2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium?
The InChIKey is WTUKPGDQTIWDDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11O.Y/c1-8-4-3-5-9(2)10(8)6-7-11;/h4-5,7H,6H2,1-2H3;/q-1;.
What are the key properties of 2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium?
2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium has a molecular weight of 236.10 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylbenzene-4-id-1-yl)acetaldehyde;yttrium is sourced from PubChem (CID 58226479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).