About methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate
methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate (PubChem CID 58226614) has the molecular formula C15H26FNO3
and a molecular weight of 287.38 g/mol. Its IUPAC name is methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate |
| PubChem CID | 58226614 |
| Molecular Formula | C15H26FNO3 |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate |
| SMILES | COC(=O)C[C@H](C(=O)N1C[C@@H](F)C[C@H]1C(C)C)C(C)C |
| InChI | InChI=1S/C15H26FNO3/c1-9(2)12(7-14(18)20-5)15(19)17-8-11(16)6-13(17)10(3)4/h9-13H,6-8H2,1-5H3/t11-,12-,13-/m0/s1 |
| InChIKey | WBFYCWNOQISJAZ-AVGNSLFASA-N |
| XLogP | 2.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate?
The IUPAC name of methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate (CID 58226614) is methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate.
What is the SMILES notation for methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate?
The canonical SMILES for methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate is COC(=O)C[C@H](C(=O)N1C[C@@H](F)C[C@H]1C(C)C)C(C)C.
What is the InChIKey of methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate?
The InChIKey is WBFYCWNOQISJAZ-AVGNSLFASA-N. The full InChI is InChI=1S/C15H26FNO3/c1-9(2)12(7-14(18)20-5)15(19)17-8-11(16)6-13(17)10(3)4/h9-13H,6-8H2,1-5H3/t11-,12-,13-/m0/s1.
What are the key properties of methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate?
methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate has a molecular weight of 287.38 g/mol, XLogP of 2.42, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3-[(2S,4S)-4-fluoro-2-propan-2-ylpyrrolidine-1-carbonyl]-4-methylpentanoate is sourced from PubChem (CID 58226614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).