C18H31NO3 — CID 58226826
methyl (3S)-3-[(2S,3aS)-2-propan-2-yl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl]-4-methylpentanoate (PubChem CID 58226826) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is methyl (3S)-3-[(2S,3aS)-2-propan-2-yl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl]-4-methylpentanoate.
| Compound Name | methyl (3S)-3-[(2S,3aS)-2-propan-2-yl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 58226826 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | methyl (3S)-3-[(2S,3aS)-2-propan-2-yl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl]-4-methylpentanoate |
| SMILES | COC(=O)C[C@H](C(=O)N1C2CCC[C@H]2C[C@H]1C(C)C)C(C)C |
| InChI | InChI=1S/C18H31NO3/c1-11(2)14(10-17(20)22-5)18(21)19-15-8-6-7-13(15)9-16(19)12(3)4/h11-16H,6-10H2,1-5H3/t13-,14-,15?,16-/m0/s1 |
| InChIKey | APWAVDYBWAPZSM-OJTCVJSUSA-N |
| XLogP | 3.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |