C7H10ClN3O2 — CID 58226892
2-tert-butyl-6-chloro-1,2,4-triazine-3,5-dione (PubChem CID 58226892) has the molecular formula C7H10ClN3O2 and a molecular weight of 203.63 g/mol. Its IUPAC name is 2-tert-butyl-6-chloro-1,2,4-triazine-3,5-dione.
| Compound Name | 2-tert-butyl-6-chloro-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 58226892 |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 2-tert-butyl-6-chloro-1,2,4-triazine-3,5-dione |
| SMILES | CC(C)(C)n1nc(Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H10ClN3O2/c1-7(2,3)11-6(13)9-5(12)4(8)10-11/h1-3H3,(H,9,12,13) |
| InChIKey | FGJPWEXIWJZKOZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |