About 5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole
5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole (PubChem CID 58227547) has the molecular formula C17H16F2N2S
and a molecular weight of 318.39 g/mol. Its IUPAC name is 5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole |
| PubChem CID | 58227547 |
| Molecular Formula | C17H16F2N2S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole |
| SMILES | FC1(F)CCCN(Cc2cnc(C#Cc3ccccc3)s2)C1 |
| InChI | InChI=1S/C17H16F2N2S/c18-17(19)9-4-10-21(13-17)12-15-11-20-16(22-15)8-7-14-5-2-1-3-6-14/h1-3,5-6,11H,4,9-10,12-13H2 |
| InChIKey | YGWHSSNILUJYOV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole?
The IUPAC name of 5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole (CID 58227547) is 5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole.
What is the SMILES notation for 5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole?
The canonical SMILES for 5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole is FC1(F)CCCN(Cc2cnc(C#Cc3ccccc3)s2)C1.
What is the InChIKey of 5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole?
The InChIKey is YGWHSSNILUJYOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2N2S/c18-17(19)9-4-10-21(13-17)12-15-11-20-16(22-15)8-7-14-5-2-1-3-6-14/h1-3,5-6,11H,4,9-10,12-13H2.
What are the key properties of 5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole?
5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole has a molecular weight of 318.39 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,3-difluoropiperidin-1-yl)methyl]-2-(2-phenylethynyl)-1,3-thiazole is sourced from PubChem (CID 58227547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).