C12H16F4N4 — CID 58227980
2-(4-fluoropiperidin-1-yl)-2-[2-(trifluoromethyl)pyrimidin-5-yl]ethanamine (PubChem CID 58227980) has the molecular formula C12H16F4N4 and a molecular weight of 292.28 g/mol. Its IUPAC name is 2-(4-fluoropiperidin-1-yl)-2-[2-(trifluoromethyl)pyrimidin-5-yl]ethanamine.
| Compound Name | 2-(4-fluoropiperidin-1-yl)-2-[2-(trifluoromethyl)pyrimidin-5-yl]ethanamine |
|---|---|
| PubChem CID | 58227980 |
| Molecular Formula | C12H16F4N4 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(4-fluoropiperidin-1-yl)-2-[2-(trifluoromethyl)pyrimidin-5-yl]ethanamine |
| SMILES | NCC(c1cnc(C(F)(F)F)nc1)N1CCC(F)CC1 |
| InChI | InChI=1S/C12H16F4N4/c13-9-1-3-20(4-2-9)10(5-17)8-6-18-11(19-7-8)12(14,15)16/h6-7,9-10H,1-5,17H2 |
| InChIKey | QIBBMNHTSYFUFR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |