About 2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine
2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine (PubChem CID 58227986) has the molecular formula C12H18F2N2S
and a molecular weight of 260.35 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine |
| PubChem CID | 58227986 |
| Molecular Formula | C12H18F2N2S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine |
| SMILES | Cc1ccc(C(CN)N2CCC(F)(F)CC2)s1 |
| InChI | InChI=1S/C12H18F2N2S/c1-9-2-3-11(17-9)10(8-15)16-6-4-12(13,14)5-7-16/h2-3,10H,4-8,15H2,1H3 |
| InChIKey | BBHJXHZFTOIMGL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine?
The IUPAC name of 2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine (CID 58227986) is 2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine.
What is the SMILES notation for 2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine?
The canonical SMILES for 2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine is Cc1ccc(C(CN)N2CCC(F)(F)CC2)s1.
What is the InChIKey of 2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine?
The InChIKey is BBHJXHZFTOIMGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2N2S/c1-9-2-3-11(17-9)10(8-15)16-6-4-12(13,14)5-7-16/h2-3,10H,4-8,15H2,1H3.
What are the key properties of 2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine?
2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine has a molecular weight of 260.35 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluoropiperidin-1-yl)-2-(5-methylthiophen-2-yl)ethanamine is sourced from PubChem (CID 58227986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).