C23H22ClF2N3O — CID 58228399
4-(2-chloro-3-pyridinyl)-4-(4,4-difluoropiperidin-1-yl)-1-quinolin-5-ylbutan-1-one (PubChem CID 58228399) has the molecular formula C23H22ClF2N3O and a molecular weight of 429.90 g/mol. Its IUPAC name is 4-(2-chloro-3-pyridinyl)-4-(4,4-difluoropiperidin-1-yl)-1-quinolin-5-ylbutan-1-one.
| Compound Name | 4-(2-chloro-3-pyridinyl)-4-(4,4-difluoropiperidin-1-yl)-1-quinolin-5-ylbutan-1-one |
|---|---|
| PubChem CID | 58228399 |
| Molecular Formula | C23H22ClF2N3O |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 4-(2-chloro-3-pyridinyl)-4-(4,4-difluoropiperidin-1-yl)-1-quinolin-5-ylbutan-1-one |
| SMILES | O=C(CCC(c1cccnc1Cl)N1CCC(F)(F)CC1)c1cccc2ncccc12 |
| InChI | InChI=1S/C23H22ClF2N3O/c24-22-18(6-3-13-28-22)20(29-14-10-23(25,26)11-15-29)8-9-21(30)17-4-1-7-19-16(17)5-2-12-27-19/h1-7,12-13,20H,8-11,14-15H2 |
| InChIKey | GHNIHLXEVORERE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|