About 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine
5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine (PubChem CID 58228495) has the molecular formula C11H17F2N5
and a molecular weight of 257.29 g/mol. Its IUPAC name is 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine |
| PubChem CID | 58228495 |
| Molecular Formula | C11H17F2N5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine |
| SMILES | NCC(c1cnc(N)nc1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H17F2N5/c12-11(13)1-3-18(4-2-11)9(5-14)8-6-16-10(15)17-7-8/h6-7,9H,1-5,14H2,(H2,15,16,17) |
| InChIKey | MRUMOCXYGPMYDS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine?
The IUPAC name of 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine (CID 58228495) is 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine.
What is the SMILES notation for 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine?
The canonical SMILES for 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine is NCC(c1cnc(N)nc1)N1CCC(F)(F)CC1.
What is the InChIKey of 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine?
The InChIKey is MRUMOCXYGPMYDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N5/c12-11(13)1-3-18(4-2-11)9(5-14)8-6-16-10(15)17-7-8/h6-7,9H,1-5,14H2,(H2,15,16,17).
What are the key properties of 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine?
5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine has a molecular weight of 257.29 g/mol, XLogP of 0.79, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]pyrimidin-2-amine is sourced from PubChem (CID 58228495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).