C22H23BF2N6O2 — CID 58228874
3-[difluoro-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 58228874) has the molecular formula C22H23BF2N6O2 and a molecular weight of 452.27 g/mol. Its IUPAC name is 3-[difluoro-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-[difluoro-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 58228874 |
| Molecular Formula | C22H23BF2N6O2 |
| Molecular Weight | 452.27 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 3-[difluoro-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Cn1cc(-c2ccc3nnc(C(F)(F)c4cccc(B5OC(C)(C)C(C)(C)O5)c4)n3n2)cn1 |
| InChI | InChI=1S/C22H23BF2N6O2/c1-20(2)21(3,4)33-23(32-20)16-8-6-7-15(11-16)22(24,25)19-28-27-18-10-9-17(29-31(18)19)14-12-26-30(5)13-14/h6-13H,1-5H3 |
| InChIKey | NZJAGYRODVNOIO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 79.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|