C19H19N3O3S — CID 58228881
methyl 2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidine-7-carboxylate (PubChem CID 58228881) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is methyl 2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidine-7-carboxylate.
| Compound Name | methyl 2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 58228881 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | methyl 2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidine-7-carboxylate |
| SMILES | COC(=O)c1csc2cnc(Cc3ccc(N4CCOCC4)cc3)nc12 |
| InChI | InChI=1S/C19H19N3O3S/c1-24-19(23)15-12-26-16-11-20-17(21-18(15)16)10-13-2-4-14(5-3-13)22-6-8-25-9-7-22/h2-5,11-12H,6-10H2,1H3 |
| InChIKey | CTUWZINMICDRQM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|