C27H26F3N5O3S — CID 58228920
1-ethyl-3-[4-[2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidin-7-yl]-2-(trifluoromethoxy)phenyl]urea (PubChem CID 58228920) has the molecular formula C27H26F3N5O3S and a molecular weight of 557.60 g/mol. Its IUPAC name is 1-ethyl-3-[4-[2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidin-7-yl]-2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-ethyl-3-[4-[2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidin-7-yl]-2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 58228920 |
| Molecular Formula | C27H26F3N5O3S |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 1-ethyl-3-[4-[2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidin-7-yl]-2-(trifluoromethoxy)phenyl]urea |
| SMILES | CCNC(=O)Nc1ccc(-c2csc3cnc(Cc4ccc(N5CCOCC5)cc4)nc23)cc1OC(F)(F)F |
| InChI | InChI=1S/C27H26F3N5O3S/c1-2-31-26(36)33-21-8-5-18(14-22(21)38-27(28,29)30)20-16-39-23-15-32-24(34-25(20)23)13-17-3-6-19(7-4-17)35-9-11-37-12-10-35/h3-8,14-16H,2,9-13H2,1H3,(H2,31,33,36) |
| InChIKey | RJGIFOIEQDINJM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|