C26H24ClFN4O3S — CID 58229449
N-[2-chloro-5-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinolin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 58229449) has the molecular formula C26H24ClFN4O3S and a molecular weight of 527.02 g/mol. Its IUPAC name is N-[2-chloro-5-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinolin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinolin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 58229449 |
| Molecular Formula | C26H24ClFN4O3S |
| Molecular Weight | 527.02 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | N-[2-chloro-5-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]quinolin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | C[C@@H]1CN(c2ccnc3ccc(-c4cnc(Cl)c(NS(=O)(=O)c5ccc(F)cc5)c4)cc23)C[C@H](C)O1 |
| InChI | InChI=1S/C26H24ClFN4O3S/c1-16-14-32(15-17(2)35-16)25-9-10-29-23-8-3-18(11-22(23)25)19-12-24(26(27)30-13-19)31-36(33,34)21-6-4-20(28)5-7-21/h3-13,16-17,31H,14-15H2,1-2H3/t16-,17+ |
| InChIKey | WOQSOVWWGCAZGR-CALCHBBNSA-N |
| XLogP | 5.50 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.02 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|