C19H25BN2O3 — CID 58229502
4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-4-yl]morpholine (PubChem CID 58229502) has the molecular formula C19H25BN2O3 and a molecular weight of 340.23 g/mol. Its IUPAC name is 4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-4-yl]morpholine.
| Compound Name | 4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-4-yl]morpholine |
|---|---|
| PubChem CID | 58229502 |
| Molecular Formula | C19H25BN2O3 |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-4-yl]morpholine |
| SMILES | CC1(C)OB(c2ccc3nccc(N4CCOCC4)c3c2)OC1(C)C |
| InChI | InChI=1S/C19H25BN2O3/c1-18(2)19(3,4)25-20(24-18)14-5-6-16-15(13-14)17(7-8-21-16)22-9-11-23-12-10-22/h5-8,13H,9-12H2,1-4H3 |
| InChIKey | YLBKJFUWDUMHAV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|