About tricyclo[6.2.2.02,7]dodeca-2,4,6-triene
tricyclo[6.2.2.02,7]dodeca-2,4,6-triene (PubChem CID 582301) has the molecular formula C12H14
and a molecular weight of 158.24 g/mol. Its IUPAC name is tricyclo[6.2.2.02,7]dodeca-2,4,6-triene.
Molecular Properties
| Compound Name | tricyclo[6.2.2.02,7]dodeca-2,4,6-triene |
| PubChem CID | 582301 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | tricyclo[6.2.2.02,7]dodeca-2,4,6-triene |
| SMILES | c1ccc2c(c1)C1CCC2CC1 |
| InChI | InChI=1S/C12H14/c1-2-4-12-10-7-5-9(6-8-10)11(12)3-1/h1-4,9-10H,5-8H2 |
| InChIKey | ORCQJRXQASSNAQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tricyclo[6.2.2.02,7]dodeca-2,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[6.2.2.02,7]dodeca-2,4,6-triene?
The IUPAC name of tricyclo[6.2.2.02,7]dodeca-2,4,6-triene (CID 582301) is tricyclo[6.2.2.02,7]dodeca-2,4,6-triene.
What is the SMILES notation for tricyclo[6.2.2.02,7]dodeca-2,4,6-triene?
The canonical SMILES for tricyclo[6.2.2.02,7]dodeca-2,4,6-triene is c1ccc2c(c1)C1CCC2CC1.
What is the InChIKey of tricyclo[6.2.2.02,7]dodeca-2,4,6-triene?
The InChIKey is ORCQJRXQASSNAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14/c1-2-4-12-10-7-5-9(6-8-10)11(12)3-1/h1-4,9-10H,5-8H2.
What are the key properties of tricyclo[6.2.2.02,7]dodeca-2,4,6-triene?
tricyclo[6.2.2.02,7]dodeca-2,4,6-triene has a molecular weight of 158.24 g/mol, XLogP of 3.44, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[6.2.2.02,7]dodeca-2,4,6-triene is sourced from PubChem (CID 582301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).