About 2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid
2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid (PubChem CID 58230450) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is 2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid |
| PubChem CID | 58230450 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid |
| SMILES | CC1NC=C(C(=O)O)C(=O)N1 |
| InChI | InChI=1S/C6H8N2O3/c1-3-7-2-4(6(10)11)5(9)8-3/h2-3,7H,1H3,(H,8,9)(H,10,11) |
| InChIKey | HBRRIXKDJFUJSY-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid?
The IUPAC name of 2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid (CID 58230450) is 2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid.
What is the SMILES notation for 2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid?
The canonical SMILES for 2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid is CC1NC=C(C(=O)O)C(=O)N1.
What is the InChIKey of 2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid?
The InChIKey is HBRRIXKDJFUJSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c1-3-7-2-4(6(10)11)5(9)8-3/h2-3,7H,1H3,(H,8,9)(H,10,11).
What are the key properties of 2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid?
2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid has a molecular weight of 156.14 g/mol, XLogP of -0.98, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-oxo-2,3-dihydro-1H-pyrimidine-5-carboxylic acid is sourced from PubChem (CID 58230450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).