C9H12N2O — CID 58230662
7-methyl-1,2,3,4-tetrahydro-1,8-naphthyridin-4-ol (PubChem CID 58230662) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 7-methyl-1,2,3,4-tetrahydro-1,8-naphthyridin-4-ol.
| Compound Name | 7-methyl-1,2,3,4-tetrahydro-1,8-naphthyridin-4-ol |
|---|---|
| PubChem CID | 58230662 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 7-methyl-1,2,3,4-tetrahydro-1,8-naphthyridin-4-ol |
| SMILES | Cc1ccc2c(n1)NCCC2O |
| InChI | InChI=1S/C9H12N2O/c1-6-2-3-7-8(12)4-5-10-9(7)11-6/h2-3,8,12H,4-5H2,1H3,(H,10,11) |
| InChIKey | UNBCQJSBVSJURY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |