About [1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol
[1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol (PubChem CID 58230789) has the molecular formula C15H19N3O
and a molecular weight of 257.34 g/mol. Its IUPAC name is [1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol |
| PubChem CID | 58230789 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | [1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol |
| SMILES | Cc1nn(Cc2ccc3c(c2)C[C@@H](N)C3)cc1CO |
| InChI | InChI=1S/C15H19N3O/c1-10-14(9-19)8-18(17-10)7-11-2-3-12-5-15(16)6-13(12)4-11/h2-4,8,15,19H,5-7,9,16H2,1H3/t15-/m0/s1 |
| InChIKey | DAUMBJIAKRBRJQ-HNNXBMFYSA-N |
| XLogP | 1.16 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol?
The IUPAC name of [1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol (CID 58230789) is [1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol.
What is the SMILES notation for [1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol?
The canonical SMILES for [1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol is Cc1nn(Cc2ccc3c(c2)C[C@@H](N)C3)cc1CO.
What is the InChIKey of [1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol?
The InChIKey is DAUMBJIAKRBRJQ-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H19N3O/c1-10-14(9-19)8-18(17-10)7-11-2-3-12-5-15(16)6-13(12)4-11/h2-4,8,15,19H,5-7,9,16H2,1H3/t15-/m0/s1.
What are the key properties of [1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol?
[1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol has a molecular weight of 257.34 g/mol, XLogP of 1.16, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[(2S)-2-amino-2,3-dihydro-1H-inden-5-yl]methyl]-3-methylpyrazol-4-yl]methanol is sourced from PubChem (CID 58230789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).