About (4R,5S)-2,4,5-trimethyl-4,5-dihydro-1,3-thiazole
(4R,5S)-2,4,5-trimethyl-4,5-dihydro-1,3-thiazole (PubChem CID 58230858) has the molecular formula C6H11NS
and a molecular weight of 129.23 g/mol. Its IUPAC name is (4R,5S)-2,4,5-trimethyl-4,5-dihydro-1,3-thiazole.
Analyze (4R,5S)-2,4,5-trimethyl-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-2,4,5-trimethyl-4,5-dihydro-1,3-thiazole?
The IUPAC name of (4R,5S)-2,4,5-trimethyl-4,5-dihydro-1,3-thiazole (CID 58230858) is (4R,5S)-2,4,5-trimethyl-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for (4R,5S)-2,4,5-trimethyl-4,5-dihydro-1,3-thiazole?
The canonical SMILES for (4R,5S)-2,4,5-trimethyl-4,5-dihydro-1,3-thiazole is CC1=N[C@H](C)[C@H](C)S1.
What is the InChIKey of (4R,5S)-2,4,5-trimethyl-4,5-dihydro-1,3-thiazole?
The InChIKey is CIEKNJJOENYFQL-UHNVWZDZSA-N. The full InChI is InChI=1S/C6H11NS/c1-4-5(2)8-6(3)7-4/h4-5H,1-3H3/t4-,5+/m1/s1.
What are the key properties of (4R,5S)-2,4,5-trimethyl-4,5-dihydro-1,3-thiazole?
(4R,5S)-2,4,5-trimethyl-4,5-dihydro-1,3-thiazole has a molecular weight of 129.23 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-2,4,5-trimethyl-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 58230858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).