C34H27Cl2F3N2O3 — CID 58231185
4-[[4-(2,4-dichlorophenyl)-2-[[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]methyl]imidazol-1-yl]methyl]benzoic acid (PubChem CID 58231185) has the molecular formula C34H27Cl2F3N2O3 and a molecular weight of 639.50 g/mol. Its IUPAC name is 4-[[4-(2,4-dichlorophenyl)-2-[[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]methyl]imidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-(2,4-dichlorophenyl)-2-[[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]methyl]imidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 58231185 |
| Molecular Formula | C34H27Cl2F3N2O3 |
| Molecular Weight | 639.50 g/mol |
| Exact Mass | 638.14 |
| IUPAC Name | 4-[[4-(2,4-dichlorophenyl)-2-[[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]methyl]imidazol-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cn2cc(-c3ccc(Cl)cc3Cl)nc2Cc2ccc(-c3ccc(OCCCC(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H27Cl2F3N2O3/c35-27-12-15-29(30(36)19-27)31-21-41(20-23-4-8-26(9-5-23)33(42)43)32(40-31)18-22-2-6-24(7-3-22)25-10-13-28(14-11-25)44-17-1-16-34(37,38)39/h2-15,19,21H,1,16-18,20H2,(H,42,43) |
| InChIKey | QAQUDVIMBQXSBD-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.50 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|