C8H13FO3 — CID 58231555
(2S,3aS,6R,6aR)-4-fluoro-2-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a,6-diol (PubChem CID 58231555) has the molecular formula C8H13FO3 and a molecular weight of 176.19 g/mol. Its IUPAC name is (2S,3aS,6R,6aR)-4-fluoro-2-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a,6-diol.
| Compound Name | (2S,3aS,6R,6aR)-4-fluoro-2-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a,6-diol |
|---|---|
| PubChem CID | 58231555 |
| Molecular Formula | C8H13FO3 |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (2S,3aS,6R,6aR)-4-fluoro-2-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a,6-diol |
| SMILES | C[C@H]1C[C@@]2(O)C(F)C[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C8H13FO3/c1-4-3-8(11)6(9)2-5(10)7(8)12-4/h4-7,10-11H,2-3H2,1H3/t4-,5+,6?,7+,8+/m0/s1 |
| InChIKey | UQKOJFHWUGOSOM-BTBCGKJZSA-N |
| XLogP | -0.00 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |