C43H39HfN2-3 — CID 58231876
carbanide;(2,6-dipropylphenyl)-[[6-(2H-naphthalen-2-id-1-yl)-2-pyridinyl]-phenanthren-9-ylmethyl]azanide;hafnium (PubChem CID 58231876) has the molecular formula C43H39HfN2-3 and a molecular weight of 762.29 g/mol. Its IUPAC name is carbanide;(2,6-dipropylphenyl)-[[6-(2H-naphthalen-2-id-1-yl)-2-pyridinyl]-phenanthren-9-ylmethyl]azanide;hafnium.
| Compound Name | carbanide;(2,6-dipropylphenyl)-[[6-(2H-naphthalen-2-id-1-yl)-2-pyridinyl]-phenanthren-9-ylmethyl]azanide;hafnium |
|---|---|
| PubChem CID | 58231876 |
| Molecular Formula | C43H39HfN2-3 |
| Molecular Weight | 762.29 g/mol |
| Exact Mass | 763.26 |
| IUPAC Name | carbanide;(2,6-dipropylphenyl)-[[6-(2H-naphthalen-2-id-1-yl)-2-pyridinyl]-phenanthren-9-ylmethyl]azanide;hafnium |
| SMILES | CCCc1cccc(CCC)c1[N-]C(c1cccc(-c2[c-]ccc3ccccc23)n1)c1cc2ccccc2c2ccccc12.[CH3-].[Hf] |
| InChI | InChI=1S/C42H36N2.CH3.Hf/c1-3-14-30-19-11-20-31(15-4-2)41(30)44-42(38-28-32-17-6-8-22-34(32)35-23-9-10-24-36(35)38)40-27-13-26-39(43-40)37-25-12-18-29-16-5-7-21-33(29)37;;/h5-13,16-24,26-28,42H,3-4,14-15H2,1-2H3;1H3;/q-2;-1; |
| InChIKey | UKODDDWPTJQANN-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 26.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.29 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|